C5H10F2OS — CID 131981930
1,1-difluoro-2-(1-methylsulfanylethoxy)ethane (PubChem CID 131981930) has the molecular formula C5H10F2OS and a molecular weight of 156.20 g/mol. Its IUPAC name is 1,1-difluoro-2-(1-methylsulfanylethoxy)ethane.
| Compound Name | 1,1-difluoro-2-(1-methylsulfanylethoxy)ethane |
|---|---|
| PubChem CID | 131981930 |
| Molecular Formula | C5H10F2OS |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 1,1-difluoro-2-(1-methylsulfanylethoxy)ethane |
| SMILES | CSC(C)OCC(F)F |
| InChI | InChI=1S/C5H10F2OS/c1-4(9-2)8-3-5(6)7/h4-5H,3H2,1-2H3 |
| InChIKey | SUKCJGGSZDRXCU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|