C6H4F10OS — CID 163198789
1,1,1,2,2,3,3-heptafluoro-3-(1,2,2-trifluoro-2-methylsulfanylethoxy)propane (PubChem CID 163198789) has the molecular formula C6H4F10OS and a molecular weight of 314.14 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluoro-3-(1,2,2-trifluoro-2-methylsulfanylethoxy)propane.
| Compound Name | 1,1,1,2,2,3,3-heptafluoro-3-(1,2,2-trifluoro-2-methylsulfanylethoxy)propane |
|---|---|
| PubChem CID | 163198789 |
| Molecular Formula | C6H4F10OS |
| Molecular Weight | 314.14 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluoro-3-(1,2,2-trifluoro-2-methylsulfanylethoxy)propane |
| SMILES | CSC(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H4F10OS/c1-18-3(8,9)2(7)17-6(15,16)4(10,11)5(12,13)14/h2H,1H3 |
| InChIKey | JZORSIUHYLZUKX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.14 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|