About 5-[3-(2,2-dimethylpropanoylamino)propanoylamino]-4-methylpentanoic acid
5-[3-(2,2-dimethylpropanoylamino)propanoylamino]-4-methylpentanoic acid (PubChem CID 82010370) has the molecular formula C14H26N2O4
and a molecular weight of 286.37 g/mol. Its IUPAC name is 5-[3-(2,2-dimethylpropanoylamino)propanoylamino]-4-methylpentanoic acid.
Molecular Properties
| Compound Name | 5-[3-(2,2-dimethylpropanoylamino)propanoylamino]-4-methylpentanoic acid |
| PubChem CID | 82010370 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 5-[3-(2,2-dimethylpropanoylamino)propanoylamino]-4-methylpentanoic acid |
| SMILES | CC(CCC(=O)O)CNC(=O)CCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H26N2O4/c1-10(5-6-12(18)19)9-16-11(17)7-8-15-13(20)14(2,3)4/h10H,5-9H2,1-4H3,(H,15,20)(H,16,17)(H,18,19) |
| InChIKey | PBIXEYWDGASXQJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[3-(2,2-dimethylpropanoylamino)propanoylamino]-4-methylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(2,2-dimethylpropanoylamino)propanoylamino]-4-methylpentanoic acid?
The IUPAC name of 5-[3-(2,2-dimethylpropanoylamino)propanoylamino]-4-methylpentanoic acid (CID 82010370) is 5-[3-(2,2-dimethylpropanoylamino)propanoylamino]-4-methylpentanoic acid.
What is the SMILES notation for 5-[3-(2,2-dimethylpropanoylamino)propanoylamino]-4-methylpentanoic acid?
The canonical SMILES for 5-[3-(2,2-dimethylpropanoylamino)propanoylamino]-4-methylpentanoic acid is CC(CCC(=O)O)CNC(=O)CCNC(=O)C(C)(C)C.
What is the InChIKey of 5-[3-(2,2-dimethylpropanoylamino)propanoylamino]-4-methylpentanoic acid?
The InChIKey is PBIXEYWDGASXQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O4/c1-10(5-6-12(18)19)9-16-11(17)7-8-15-13(20)14(2,3)4/h10H,5-9H2,1-4H3,(H,15,20)(H,16,17)(H,18,19).
What are the key properties of 5-[3-(2,2-dimethylpropanoylamino)propanoylamino]-4-methylpentanoic acid?
5-[3-(2,2-dimethylpropanoylamino)propanoylamino]-4-methylpentanoic acid has a molecular weight of 286.37 g/mol, XLogP of 1.16, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(2,2-dimethylpropanoylamino)propanoylamino]-4-methylpentanoic acid is sourced from PubChem (CID 82010370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).