C8H15ClF2O3S — CID 82010517
5-(2,2-difluoroethoxy)-3-methylpentane-1-sulfonyl chloride (PubChem CID 82010517) has the molecular formula C8H15ClF2O3S and a molecular weight of 264.72 g/mol. Its IUPAC name is 5-(2,2-difluoroethoxy)-3-methylpentane-1-sulfonyl chloride.
| Compound Name | 5-(2,2-difluoroethoxy)-3-methylpentane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 82010517 |
| Molecular Formula | C8H15ClF2O3S |
| Molecular Weight | 264.72 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 5-(2,2-difluoroethoxy)-3-methylpentane-1-sulfonyl chloride |
| SMILES | CC(CCOCC(F)F)CCS(=O)(=O)Cl |
| InChI | InChI=1S/C8H15ClF2O3S/c1-7(3-5-15(9,12)13)2-4-14-6-8(10)11/h7-8H,2-6H2,1H3 |
| InChIKey | HPXQCTPGCVEDBK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.72 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|