C15H15BrN2O2S — CID 82012325
2-bromo-N-(2-methyl-3-nitrophenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 82012325) has the molecular formula C15H15BrN2O2S and a molecular weight of 367.27 g/mol. Its IUPAC name is 2-bromo-N-(2-methyl-3-nitrophenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | 2-bromo-N-(2-methyl-3-nitrophenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 82012325 |
| Molecular Formula | C15H15BrN2O2S |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 2-bromo-N-(2-methyl-3-nitrophenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | Cc1c(NC2CCCc3sc(Br)cc32)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15BrN2O2S/c1-9-11(4-2-6-13(9)18(19)20)17-12-5-3-7-14-10(12)8-15(16)21-14/h2,4,6,8,12,17H,3,5,7H2,1H3 |
| InChIKey | UOLLYOFKHGHLIC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|