C11H16N2O3S — CID 82014771
4-methyl-5-(thiophen-3-ylcarbamoylamino)pentanoic acid (PubChem CID 82014771) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 4-methyl-5-(thiophen-3-ylcarbamoylamino)pentanoic acid.
| Compound Name | 4-methyl-5-(thiophen-3-ylcarbamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 82014771 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 4-methyl-5-(thiophen-3-ylcarbamoylamino)pentanoic acid |
| SMILES | CC(CCC(=O)O)CNC(=O)Nc1ccsc1 |
| InChI | InChI=1S/C11H16N2O3S/c1-8(2-3-10(14)15)6-12-11(16)13-9-4-5-17-7-9/h4-5,7-8H,2-3,6H2,1H3,(H,14,15)(H2,12,13,16) |
| InChIKey | OTEATAAEKNBDLT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |