C11H13FN2O3S — CID 82016327
N-(2-cyano-4-fluorophenyl)-2-ethoxyethanesulfonamide (PubChem CID 82016327) has the molecular formula C11H13FN2O3S and a molecular weight of 272.30 g/mol. Its IUPAC name is N-(2-cyano-4-fluorophenyl)-2-ethoxyethanesulfonamide.
| Compound Name | N-(2-cyano-4-fluorophenyl)-2-ethoxyethanesulfonamide |
|---|---|
| PubChem CID | 82016327 |
| Molecular Formula | C11H13FN2O3S |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | N-(2-cyano-4-fluorophenyl)-2-ethoxyethanesulfonamide |
| SMILES | CCOCCS(=O)(=O)Nc1ccc(F)cc1C#N |
| InChI | InChI=1S/C11H13FN2O3S/c1-2-17-5-6-18(15,16)14-11-4-3-10(12)7-9(11)8-13/h3-4,7,14H,2,5-6H2,1H3 |
| InChIKey | XIBHOONVGDYANW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|