C13H15N3O4 — CID 82017351
ethyl 2-(2-ethoxy-3-oxopyrido[2,3-b]pyrazin-4-yl)acetate (PubChem CID 82017351) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is ethyl 2-(2-ethoxy-3-oxopyrido[2,3-b]pyrazin-4-yl)acetate.
| Compound Name | ethyl 2-(2-ethoxy-3-oxopyrido[2,3-b]pyrazin-4-yl)acetate |
|---|---|
| PubChem CID | 82017351 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | ethyl 2-(2-ethoxy-3-oxopyrido[2,3-b]pyrazin-4-yl)acetate |
| SMILES | CCOC(=O)Cn1c(=O)c(OCC)nc2cccnc21 |
| InChI | InChI=1S/C13H15N3O4/c1-3-19-10(17)8-16-11-9(6-5-7-14-11)15-12(13(16)18)20-4-2/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | UKQFQRMAKNKUQX-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |