C16H16FN5O2 — CID 82018468
10-(4-fluorophenyl)-1-methyl-6,7,8,9-tetrahydropurino[7,8-a][1,3]diazepine-2,4-dione (PubChem CID 82018468) has the molecular formula C16H16FN5O2 and a molecular weight of 329.33 g/mol. Its IUPAC name is 10-(4-fluorophenyl)-1-methyl-6,7,8,9-tetrahydropurino[7,8-a][1,3]diazepine-2,4-dione.
| Compound Name | 10-(4-fluorophenyl)-1-methyl-6,7,8,9-tetrahydropurino[7,8-a][1,3]diazepine-2,4-dione |
|---|---|
| PubChem CID | 82018468 |
| Molecular Formula | C16H16FN5O2 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 10-(4-fluorophenyl)-1-methyl-6,7,8,9-tetrahydropurino[7,8-a][1,3]diazepine-2,4-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc1n2CCCCN1c1ccc(F)cc1 |
| InChI | InChI=1S/C16H16FN5O2/c1-20-13-12(14(23)19-16(20)24)22-9-3-2-8-21(15(22)18-13)11-6-4-10(17)5-7-11/h4-7H,2-3,8-9H2,1H3,(H,19,23,24) |
| InChIKey | DUTHSFKEGBPROH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 75.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |