C21H24N6O3 — CID 82018503
1-(3,3-dimethyl-2-oxobutyl)-7,9-dimethyl-3-phenyl-4H-purino[8,7-c][1,2,4]triazine-6,8-dione (PubChem CID 82018503) has the molecular formula C21H24N6O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is 1-(3,3-dimethyl-2-oxobutyl)-7,9-dimethyl-3-phenyl-4H-purino[8,7-c][1,2,4]triazine-6,8-dione.
| Compound Name | 1-(3,3-dimethyl-2-oxobutyl)-7,9-dimethyl-3-phenyl-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
|---|---|
| PubChem CID | 82018503 |
| Molecular Formula | C21H24N6O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 1-(3,3-dimethyl-2-oxobutyl)-7,9-dimethyl-3-phenyl-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
| SMILES | Cn1c(=O)c2c(nc3n2CC(c2ccccc2)=NN3CC(=O)C(C)(C)C)n(C)c1=O |
| InChI | InChI=1S/C21H24N6O3/c1-21(2,3)15(28)12-27-19-22-17-16(18(29)25(5)20(30)24(17)4)26(19)11-14(23-27)13-9-7-6-8-10-13/h6-10H,11-12H2,1-5H3 |
| InChIKey | AMATWXQPRWMJOI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 94.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |