C17H25N3O2 — CID 82019372
6-amino-2-ethyl-4-(2-piperidin-1-ylethyl)-1,4-benzoxazin-3-one (PubChem CID 82019372) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 6-amino-2-ethyl-4-(2-piperidin-1-ylethyl)-1,4-benzoxazin-3-one.
| Compound Name | 6-amino-2-ethyl-4-(2-piperidin-1-ylethyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82019372 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 6-amino-2-ethyl-4-(2-piperidin-1-ylethyl)-1,4-benzoxazin-3-one |
| SMILES | CCC1Oc2ccc(N)cc2N(CCN2CCCCC2)C1=O |
| InChI | InChI=1S/C17H25N3O2/c1-2-15-17(21)20(11-10-19-8-4-3-5-9-19)14-12-13(18)6-7-16(14)22-15/h6-7,12,15H,2-5,8-11,18H2,1H3 |
| InChIKey | UGRPABBQXDLMPZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|