C15H18ClNO3 — CID 82019447
6-(2-chloropropanoyl)-2-methyl-4-propan-2-yl-1,4-benzoxazin-3-one (PubChem CID 82019447) has the molecular formula C15H18ClNO3 and a molecular weight of 295.77 g/mol. Its IUPAC name is 6-(2-chloropropanoyl)-2-methyl-4-propan-2-yl-1,4-benzoxazin-3-one.
| Compound Name | 6-(2-chloropropanoyl)-2-methyl-4-propan-2-yl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82019447 |
| Molecular Formula | C15H18ClNO3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 6-(2-chloropropanoyl)-2-methyl-4-propan-2-yl-1,4-benzoxazin-3-one |
| SMILES | CC(Cl)C(=O)c1ccc2c(c1)N(C(C)C)C(=O)C(C)O2 |
| InChI | InChI=1S/C15H18ClNO3/c1-8(2)17-12-7-11(14(18)9(3)16)5-6-13(12)20-10(4)15(17)19/h5-10H,1-4H3 |
| InChIKey | OYAAZEVFPDHTNY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|