C15H18N2O3 — CID 82339948
6-(2-aminopropanoyl)-2-methyl-4-prop-2-enyl-1,4-benzoxazin-3-one (PubChem CID 82339948) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 6-(2-aminopropanoyl)-2-methyl-4-prop-2-enyl-1,4-benzoxazin-3-one.
| Compound Name | 6-(2-aminopropanoyl)-2-methyl-4-prop-2-enyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82339948 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 6-(2-aminopropanoyl)-2-methyl-4-prop-2-enyl-1,4-benzoxazin-3-one |
| SMILES | C=CCN1C(=O)C(C)Oc2ccc(C(=O)C(C)N)cc21 |
| InChI | InChI=1S/C15H18N2O3/c1-4-7-17-12-8-11(14(18)9(2)16)5-6-13(12)20-10(3)15(17)19/h4-6,8-10H,1,7,16H2,2-3H3 |
| InChIKey | RAPINIDZYWOIJV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|