C11H13ClN4 — CID 82021393
5-[2-(2-chlorophenyl)ethyl]-4-methyl-1,2,4-triazol-3-amine (PubChem CID 82021393) has the molecular formula C11H13ClN4 and a molecular weight of 236.71 g/mol. Its IUPAC name is 5-[2-(2-chlorophenyl)ethyl]-4-methyl-1,2,4-triazol-3-amine.
| Compound Name | 5-[2-(2-chlorophenyl)ethyl]-4-methyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 82021393 |
| Molecular Formula | C11H13ClN4 |
| Molecular Weight | 236.71 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 5-[2-(2-chlorophenyl)ethyl]-4-methyl-1,2,4-triazol-3-amine |
| SMILES | Cn1c(N)nnc1CCc1ccccc1Cl |
| InChI | InChI=1S/C11H13ClN4/c1-16-10(14-15-11(16)13)7-6-8-4-2-3-5-9(8)12/h2-5H,6-7H2,1H3,(H2,13,15) |
| InChIKey | XTCNMHHCXDQEDN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.71 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |