C10H10Cl2N2O — CID 82023057
2-amino-4-(2,6-dichlorophenoxy)butanenitrile (PubChem CID 82023057) has the molecular formula C10H10Cl2N2O and a molecular weight of 245.11 g/mol. Its IUPAC name is 2-amino-4-(2,6-dichlorophenoxy)butanenitrile.
| Compound Name | 2-amino-4-(2,6-dichlorophenoxy)butanenitrile |
|---|---|
| PubChem CID | 82023057 |
| Molecular Formula | C10H10Cl2N2O |
| Molecular Weight | 245.11 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 2-amino-4-(2,6-dichlorophenoxy)butanenitrile |
| SMILES | N#CC(N)CCOc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H10Cl2N2O/c11-8-2-1-3-9(12)10(8)15-5-4-7(14)6-13/h1-3,7H,4-5,14H2 |
| InChIKey | JRVZSWJXMQRQOO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.11 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |