C14H21N3O — CID 82023787
5-methoxy-1-methyl-3-piperazin-1-yl-2,3-dihydroindole (PubChem CID 82023787) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 5-methoxy-1-methyl-3-piperazin-1-yl-2,3-dihydroindole.
| Compound Name | 5-methoxy-1-methyl-3-piperazin-1-yl-2,3-dihydroindole |
|---|---|
| PubChem CID | 82023787 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 5-methoxy-1-methyl-3-piperazin-1-yl-2,3-dihydroindole |
| SMILES | COc1ccc2c(c1)C(N1CCNCC1)CN2C |
| InChI | InChI=1S/C14H21N3O/c1-16-10-14(17-7-5-15-6-8-17)12-9-11(18-2)3-4-13(12)16/h3-4,9,14-15H,5-8,10H2,1-2H3 |
| InChIKey | XMEXTDWTZDFJIS-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|