C12H16N2O — CID 23456506
9-methoxy-1,2,3,4,6,10b-hexahydropyrazino[2,1-a]isoindole (PubChem CID 23456506) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 9-methoxy-1,2,3,4,6,10b-hexahydropyrazino[2,1-a]isoindole.
| Compound Name | 9-methoxy-1,2,3,4,6,10b-hexahydropyrazino[2,1-a]isoindole |
|---|---|
| PubChem CID | 23456506 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 9-methoxy-1,2,3,4,6,10b-hexahydropyrazino[2,1-a]isoindole |
| SMILES | COc1ccc2c(c1)C1CNCCN1C2 |
| InChI | InChI=1S/C12H16N2O/c1-15-10-3-2-9-8-14-5-4-13-7-12(14)11(9)6-10/h2-3,6,12-13H,4-5,7-8H2,1H3 |
| InChIKey | UOLAPQGEEMDIIV-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |