C18H17ClN2O3 — CID 122444716
2-(6-methoxy-1,2,3,4-tetrahydroisoquinolin-4-yl)isoindole-1,3-dione;hydrochloride (PubChem CID 122444716) has the molecular formula C18H17ClN2O3 and a molecular weight of 344.80 g/mol. Its IUPAC name is 2-(6-methoxy-1,2,3,4-tetrahydroisoquinolin-4-yl)isoindole-1,3-dione;hydrochloride.
| Compound Name | 2-(6-methoxy-1,2,3,4-tetrahydroisoquinolin-4-yl)isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 122444716 |
| Molecular Formula | C18H17ClN2O3 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 2-(6-methoxy-1,2,3,4-tetrahydroisoquinolin-4-yl)isoindole-1,3-dione;hydrochloride |
| SMILES | COc1ccc2c(c1)C(N1C(=O)c3ccccc3C1=O)CNC2.Cl |
| InChI | InChI=1S/C18H16N2O3.ClH/c1-23-12-7-6-11-9-19-10-16(15(11)8-12)20-17(21)13-4-2-3-5-14(13)18(20)22;/h2-8,16,19H,9-10H2,1H3;1H |
| InChIKey | KVKAEFDZJMBVHK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|