C10H13ClS — CID 82025068
3-(chloromethyl)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene (PubChem CID 82025068) has the molecular formula C10H13ClS and a molecular weight of 200.73 g/mol. Its IUPAC name is 3-(chloromethyl)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene.
| Compound Name | 3-(chloromethyl)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene |
|---|---|
| PubChem CID | 82025068 |
| Molecular Formula | C10H13ClS |
| Molecular Weight | 200.73 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 3-(chloromethyl)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene |
| SMILES | CC1CCc2c(CCl)csc2C1 |
| InChI | InChI=1S/C10H13ClS/c1-7-2-3-9-8(5-11)6-12-10(9)4-7/h6-7H,2-5H2,1H3 |
| InChIKey | IHKSQDGCUUESCR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.73 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|