C15H24N2O — CID 82025271
2-ethyl-4-pentyl-2,3-dihydro-1,4-benzoxazin-7-amine (PubChem CID 82025271) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-ethyl-4-pentyl-2,3-dihydro-1,4-benzoxazin-7-amine.
| Compound Name | 2-ethyl-4-pentyl-2,3-dihydro-1,4-benzoxazin-7-amine |
|---|---|
| PubChem CID | 82025271 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 2-ethyl-4-pentyl-2,3-dihydro-1,4-benzoxazin-7-amine |
| SMILES | CCCCCN1CC(CC)Oc2cc(N)ccc21 |
| InChI | InChI=1S/C15H24N2O/c1-3-5-6-9-17-11-13(4-2)18-15-10-12(16)7-8-14(15)17/h7-8,10,13H,3-6,9,11,16H2,1-2H3 |
| InChIKey | HMDAMARVMHZQBC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|