C19H32N2O — CID 82162228
2,2-diethyl-4-heptyl-3H-1,4-benzoxazin-7-amine (PubChem CID 82162228) has the molecular formula C19H32N2O and a molecular weight of 304.48 g/mol. Its IUPAC name is 2,2-diethyl-4-heptyl-3H-1,4-benzoxazin-7-amine.
| Compound Name | 2,2-diethyl-4-heptyl-3H-1,4-benzoxazin-7-amine |
|---|---|
| PubChem CID | 82162228 |
| Molecular Formula | C19H32N2O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | 2,2-diethyl-4-heptyl-3H-1,4-benzoxazin-7-amine |
| SMILES | CCCCCCCN1CC(CC)(CC)Oc2cc(N)ccc21 |
| InChI | InChI=1S/C19H32N2O/c1-4-7-8-9-10-13-21-15-19(5-2,6-3)22-18-14-16(20)11-12-17(18)21/h11-12,14H,4-10,13,15,20H2,1-3H3 |
| InChIKey | XMBATEWAWMIEOK-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|