About 2,2-diethyl-4-hexyl-3H-1,4-benzoxazin-6-amine
2,2-diethyl-4-hexyl-3H-1,4-benzoxazin-6-amine (PubChem CID 82162242) has the molecular formula C18H30N2O
and a molecular weight of 290.45 g/mol. Its IUPAC name is 2,2-diethyl-4-hexyl-3H-1,4-benzoxazin-6-amine.
Molecular Properties
| Compound Name | 2,2-diethyl-4-hexyl-3H-1,4-benzoxazin-6-amine |
| PubChem CID | 82162242 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | 2,2-diethyl-4-hexyl-3H-1,4-benzoxazin-6-amine |
| SMILES | CCCCCCN1CC(CC)(CC)Oc2ccc(N)cc21 |
| InChI | InChI=1S/C18H30N2O/c1-4-7-8-9-12-20-14-18(5-2,6-3)21-17-11-10-15(19)13-16(17)20/h10-11,13H,4-9,12,14,19H2,1-3H3 |
| InChIKey | ZFXKXYUELGEXRJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diethyl-4-hexyl-3H-1,4-benzoxazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethyl-4-hexyl-3H-1,4-benzoxazin-6-amine?
The IUPAC name of 2,2-diethyl-4-hexyl-3H-1,4-benzoxazin-6-amine (CID 82162242) is 2,2-diethyl-4-hexyl-3H-1,4-benzoxazin-6-amine.
What is the SMILES notation for 2,2-diethyl-4-hexyl-3H-1,4-benzoxazin-6-amine?
The canonical SMILES for 2,2-diethyl-4-hexyl-3H-1,4-benzoxazin-6-amine is CCCCCCN1CC(CC)(CC)Oc2ccc(N)cc21.
What is the InChIKey of 2,2-diethyl-4-hexyl-3H-1,4-benzoxazin-6-amine?
The InChIKey is ZFXKXYUELGEXRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N2O/c1-4-7-8-9-12-20-14-18(5-2,6-3)21-17-11-10-15(19)13-16(17)20/h10-11,13H,4-9,12,14,19H2,1-3H3.
What are the key properties of 2,2-diethyl-4-hexyl-3H-1,4-benzoxazin-6-amine?
2,2-diethyl-4-hexyl-3H-1,4-benzoxazin-6-amine has a molecular weight of 290.45 g/mol, XLogP of 4.61, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethyl-4-hexyl-3H-1,4-benzoxazin-6-amine is sourced from PubChem (CID 82162242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).