C18H30N2O — CID 82162242
2,2-diethyl-4-hexyl-3H-1,4-benzoxazin-6-amine (PubChem CID 82162242) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is 2,2-diethyl-4-hexyl-3H-1,4-benzoxazin-6-amine.
| Compound Name | 2,2-diethyl-4-hexyl-3H-1,4-benzoxazin-6-amine |
|---|---|
| PubChem CID | 82162242 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | 2,2-diethyl-4-hexyl-3H-1,4-benzoxazin-6-amine |
| SMILES | CCCCCCN1CC(CC)(CC)Oc2ccc(N)cc21 |
| InChI | InChI=1S/C18H30N2O/c1-4-7-8-9-12-20-14-18(5-2,6-3)21-17-11-10-15(19)13-16(17)20/h10-11,13H,4-9,12,14,19H2,1-3H3 |
| InChIKey | ZFXKXYUELGEXRJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|