C20H26N2O2 — CID 82162518
3-[2-(2,2-diethyl-3H-1,4-benzoxazin-4-yl)ethoxy]aniline (PubChem CID 82162518) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 3-[2-(2,2-diethyl-3H-1,4-benzoxazin-4-yl)ethoxy]aniline.
| Compound Name | 3-[2-(2,2-diethyl-3H-1,4-benzoxazin-4-yl)ethoxy]aniline |
|---|---|
| PubChem CID | 82162518 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 3-[2-(2,2-diethyl-3H-1,4-benzoxazin-4-yl)ethoxy]aniline |
| SMILES | CCC1(CC)CN(CCOc2cccc(N)c2)c2ccccc2O1 |
| InChI | InChI=1S/C20H26N2O2/c1-3-20(4-2)15-22(18-10-5-6-11-19(18)24-20)12-13-23-17-9-7-8-16(21)14-17/h5-11,14H,3-4,12-13,15,21H2,1-2H3 |
| InChIKey | FAQYUOYYPQDHKE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|