C14H21NO3 — CID 82162214
2,2-diethyl-4-(2-hydroxyethyl)-3H-1,4-benzoxazin-7-ol (PubChem CID 82162214) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2,2-diethyl-4-(2-hydroxyethyl)-3H-1,4-benzoxazin-7-ol.
| Compound Name | 2,2-diethyl-4-(2-hydroxyethyl)-3H-1,4-benzoxazin-7-ol |
|---|---|
| PubChem CID | 82162214 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2,2-diethyl-4-(2-hydroxyethyl)-3H-1,4-benzoxazin-7-ol |
| SMILES | CCC1(CC)CN(CCO)c2ccc(O)cc2O1 |
| InChI | InChI=1S/C14H21NO3/c1-3-14(4-2)10-15(7-8-16)12-6-5-11(17)9-13(12)18-14/h5-6,9,16-17H,3-4,7-8,10H2,1-2H3 |
| InChIKey | KRZSTHSDXDOFRO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |