C15H21NO2 — CID 82162202
2,2-diethyl-4-prop-2-enyl-3H-1,4-benzoxazin-7-ol (PubChem CID 82162202) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 2,2-diethyl-4-prop-2-enyl-3H-1,4-benzoxazin-7-ol.
| Compound Name | 2,2-diethyl-4-prop-2-enyl-3H-1,4-benzoxazin-7-ol |
|---|---|
| PubChem CID | 82162202 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 2,2-diethyl-4-prop-2-enyl-3H-1,4-benzoxazin-7-ol |
| SMILES | C=CCN1CC(CC)(CC)Oc2cc(O)ccc21 |
| InChI | InChI=1S/C15H21NO2/c1-4-9-16-11-15(5-2,6-3)18-14-10-12(17)7-8-13(14)16/h4,7-8,10,17H,1,5-6,9,11H2,2-3H3 |
| InChIKey | DRBNHZJKIHACLX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|