C20H25NO2 — CID 94777170
2,2-diethyl-4-[(2-methylphenyl)methyl]-3H-1,4-benzoxazin-7-ol (PubChem CID 94777170) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 2,2-diethyl-4-[(2-methylphenyl)methyl]-3H-1,4-benzoxazin-7-ol.
| Compound Name | 2,2-diethyl-4-[(2-methylphenyl)methyl]-3H-1,4-benzoxazin-7-ol |
|---|---|
| PubChem CID | 94777170 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 2,2-diethyl-4-[(2-methylphenyl)methyl]-3H-1,4-benzoxazin-7-ol |
| SMILES | CCC1(CC)CN(Cc2ccccc2C)c2ccc(O)cc2O1 |
| InChI | InChI=1S/C20H25NO2/c1-4-20(5-2)14-21(13-16-9-7-6-8-15(16)3)18-11-10-17(22)12-19(18)23-20/h6-12,22H,4-5,13-14H2,1-3H3 |
| InChIKey | TYBXGKYSAUURIP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |