3-(5-ethyl-1,3,4-oxadiazol-2-yl)-3-phenylpropanoic acid

C13H14N2O3 — CID 82026604

IUPAC3-(5-ethyl-1,3,4-oxadiazol-2-yl)-3-phenylpropanoic acid
SMILESCCc1nnc(C(CC(=O)O)c2ccccc2)o1
InChIInChI=1S/C13H14N2O3/c1-2-11-14-15-13(18-11)10(8-12(16)17)9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3,(H,16,17)
InChIKeyQYLXYZOQIVRMON-UHFFFAOYSA-N
MW246.27 g/mol
LogP2.24
Rot. Bonds5

About 3-(5-ethyl-1,3,4-oxadiazol-2-yl)-3-phenylpropanoic acid

3-(5-ethyl-1,3,4-oxadiazol-2-yl)-3-phenylpropanoic acid (PubChem CID 82026604) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 3-(5-ethyl-1,3,4-oxadiazol-2-yl)-3-phenylpropanoic acid.

Molecular Properties

Compound Name3-(5-ethyl-1,3,4-oxadiazol-2-yl)-3-phenylpropanoic acid
PubChem CID82026604
Molecular FormulaC13H14N2O3
Molecular Weight246.27 g/mol
Exact Mass246.10
IUPAC Name3-(5-ethyl-1,3,4-oxadiazol-2-yl)-3-phenylpropanoic acid
SMILESCCc1nnc(C(CC(=O)O)c2ccccc2)o1
InChIInChI=1S/C13H14N2O3/c1-2-11-14-15-13(18-11)10(8-12(16)17)9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3,(H,16,17)
InChIKeyQYLXYZOQIVRMON-UHFFFAOYSA-N
XLogP2.24
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.27
LogP ≤ 52.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(5-ethyl-1,3,4-oxadiazol-2-yl)-3-phenylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(5-ethyl-1,3,4-oxadiazol-2-yl)-3-phenylpropanoic acid?
The IUPAC name of 3-(5-ethyl-1,3,4-oxadiazol-2-yl)-3-phenylpropanoic acid (CID 82026604) is 3-(5-ethyl-1,3,4-oxadiazol-2-yl)-3-phenylpropanoic acid.
What is the SMILES notation for 3-(5-ethyl-1,3,4-oxadiazol-2-yl)-3-phenylpropanoic acid?
The canonical SMILES for 3-(5-ethyl-1,3,4-oxadiazol-2-yl)-3-phenylpropanoic acid is CCc1nnc(C(CC(=O)O)c2ccccc2)o1.
What is the InChIKey of 3-(5-ethyl-1,3,4-oxadiazol-2-yl)-3-phenylpropanoic acid?
The InChIKey is QYLXYZOQIVRMON-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O3/c1-2-11-14-15-13(18-11)10(8-12(16)17)9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3,(H,16,17).
What are the key properties of 3-(5-ethyl-1,3,4-oxadiazol-2-yl)-3-phenylpropanoic acid?
3-(5-ethyl-1,3,4-oxadiazol-2-yl)-3-phenylpropanoic acid has a molecular weight of 246.27 g/mol, XLogP of 2.24, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-ethyl-1,3,4-oxadiazol-2-yl)-3-phenylpropanoic acid is sourced from PubChem (CID 82026604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).