C11H12N2O2 — CID 101417641
(S)-(5-ethyl-1,3,4-oxadiazol-2-yl)-phenylmethanol (PubChem CID 101417641) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is (S)-(5-ethyl-1,3,4-oxadiazol-2-yl)-phenylmethanol.
| Compound Name | (S)-(5-ethyl-1,3,4-oxadiazol-2-yl)-phenylmethanol |
|---|---|
| PubChem CID | 101417641 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | (S)-(5-ethyl-1,3,4-oxadiazol-2-yl)-phenylmethanol |
| SMILES | CCc1nnc([C@@H](O)c2ccccc2)o1 |
| InChI | InChI=1S/C11H12N2O2/c1-2-9-12-13-11(15-9)10(14)8-6-4-3-5-7-8/h3-7,10,14H,2H2,1H3/t10-/m0/s1 |
| InChIKey | IRKMNHCWUYWHGJ-JTQLQIEISA-N |
| XLogP | 1.71 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |