C14H15NS — CID 82028256
4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophen-2-amine (PubChem CID 82028256) has the molecular formula C14H15NS and a molecular weight of 229.35 g/mol. Its IUPAC name is 4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophen-2-amine.
| Compound Name | 4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophen-2-amine |
|---|---|
| PubChem CID | 82028256 |
| Molecular Formula | C14H15NS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophen-2-amine |
| SMILES | Nc1cc(-c2ccc3c(c2)CCCC3)cs1 |
| InChI | InChI=1S/C14H15NS/c15-14-8-13(9-16-14)12-6-5-10-3-1-2-4-11(10)7-12/h5-9H,1-4,15H2 |
| InChIKey | YSLKHUKXHKBOPR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |