C16H23N3O3 — CID 82028591
2-[6-(1-aminobutyl)-2-ethyl-3-oxo-1,4-benzoxazin-4-yl]acetamide (PubChem CID 82028591) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-[6-(1-aminobutyl)-2-ethyl-3-oxo-1,4-benzoxazin-4-yl]acetamide.
| Compound Name | 2-[6-(1-aminobutyl)-2-ethyl-3-oxo-1,4-benzoxazin-4-yl]acetamide |
|---|---|
| PubChem CID | 82028591 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 2-[6-(1-aminobutyl)-2-ethyl-3-oxo-1,4-benzoxazin-4-yl]acetamide |
| SMILES | CCCC(N)c1ccc2c(c1)N(CC(N)=O)C(=O)C(CC)O2 |
| InChI | InChI=1S/C16H23N3O3/c1-3-5-11(17)10-6-7-14-12(8-10)19(9-15(18)20)16(21)13(4-2)22-14/h6-8,11,13H,3-5,9,17H2,1-2H3,(H2,18,20) |
| InChIKey | SLJHCYVLSLGHLU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |