C17H22N4O4 — CID 82028927
2-[3-[(2-ethylpiperidin-1-yl)methyl]-6-nitroimidazo[1,2-a]pyridin-2-yl]acetic acid (PubChem CID 82028927) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-[3-[(2-ethylpiperidin-1-yl)methyl]-6-nitroimidazo[1,2-a]pyridin-2-yl]acetic acid.
| Compound Name | 2-[3-[(2-ethylpiperidin-1-yl)methyl]-6-nitroimidazo[1,2-a]pyridin-2-yl]acetic acid |
|---|---|
| PubChem CID | 82028927 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 2-[3-[(2-ethylpiperidin-1-yl)methyl]-6-nitroimidazo[1,2-a]pyridin-2-yl]acetic acid |
| SMILES | CCC1CCCCN1Cc1c(CC(=O)O)nc2ccc([N+](=O)[O-])cn12 |
| InChI | InChI=1S/C17H22N4O4/c1-2-12-5-3-4-8-19(12)11-15-14(9-17(22)23)18-16-7-6-13(21(24)25)10-20(15)16/h6-7,10,12H,2-5,8-9,11H2,1H3,(H,22,23) |
| InChIKey | XMSZDVIXNFEIMR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|