C16H22N4O4 — CID 39120355
2-[3-[[tert-butyl(ethyl)amino]methyl]-6-nitroimidazo[1,2-a]pyridin-2-yl]acetic acid (PubChem CID 39120355) has the molecular formula C16H22N4O4 and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-[3-[[tert-butyl(ethyl)amino]methyl]-6-nitroimidazo[1,2-a]pyridin-2-yl]acetic acid.
| Compound Name | 2-[3-[[tert-butyl(ethyl)amino]methyl]-6-nitroimidazo[1,2-a]pyridin-2-yl]acetic acid |
|---|---|
| PubChem CID | 39120355 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 2-[3-[[tert-butyl(ethyl)amino]methyl]-6-nitroimidazo[1,2-a]pyridin-2-yl]acetic acid |
| SMILES | CCN(Cc1c(CC(=O)O)nc2ccc([N+](=O)[O-])cn12)C(C)(C)C |
| InChI | InChI=1S/C16H22N4O4/c1-5-18(16(2,3)4)10-13-12(8-15(21)22)17-14-7-6-11(20(23)24)9-19(13)14/h6-7,9H,5,8,10H2,1-4H3,(H,21,22) |
| InChIKey | LPAASFICNXINLK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|