C11H15N3 — CID 82029094
1-(7-methylimidazo[1,2-a]pyridin-3-yl)propan-1-amine (PubChem CID 82029094) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 1-(7-methylimidazo[1,2-a]pyridin-3-yl)propan-1-amine.
| Compound Name | 1-(7-methylimidazo[1,2-a]pyridin-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 82029094 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 1-(7-methylimidazo[1,2-a]pyridin-3-yl)propan-1-amine |
| SMILES | CCC(N)c1cnc2cc(C)ccn12 |
| InChI | InChI=1S/C11H15N3/c1-3-9(12)10-7-13-11-6-8(2)4-5-14(10)11/h4-7,9H,3,12H2,1-2H3 |
| InChIKey | VALFNBDQUAECRJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |