C9H7N3O — CID 83914637
3-isocyanato-7-methylimidazo[1,2-a]pyridine (PubChem CID 83914637) has the molecular formula C9H7N3O and a molecular weight of 173.17 g/mol. Its IUPAC name is 3-isocyanato-7-methylimidazo[1,2-a]pyridine.
| Compound Name | 3-isocyanato-7-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 83914637 |
| Molecular Formula | C9H7N3O |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 3-isocyanato-7-methylimidazo[1,2-a]pyridine |
| SMILES | Cc1ccn2c(N=C=O)cnc2c1 |
| InChI | InChI=1S/C9H7N3O/c1-7-2-3-12-8(4-7)10-5-9(12)11-6-13/h2-5H,1H3 |
| InChIKey | TYMKIBPUEIBKML-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 46.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|