C14H17ClN2O4 — CID 82031417
1-[4-(5-chloro-2-oxo-1-pyridinyl)butanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 82031417) has the molecular formula C14H17ClN2O4 and a molecular weight of 312.75 g/mol. Its IUPAC name is 1-[4-(5-chloro-2-oxo-1-pyridinyl)butanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[4-(5-chloro-2-oxo-1-pyridinyl)butanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 82031417 |
| Molecular Formula | C14H17ClN2O4 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 1-[4-(5-chloro-2-oxo-1-pyridinyl)butanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCN1C(=O)CCCn1cc(Cl)ccc1=O |
| InChI | InChI=1S/C14H17ClN2O4/c15-10-5-6-12(18)16(9-10)7-2-4-13(19)17-8-1-3-11(17)14(20)21/h5-6,9,11H,1-4,7-8H2,(H,20,21) |
| InChIKey | VLHDRDGNADFRPI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |