C14H20N2O4 — CID 82031547
2-[2-(2-methyl-6-oxo-1-pyridinyl)butanoylamino]butanoic acid (PubChem CID 82031547) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-[2-(2-methyl-6-oxo-1-pyridinyl)butanoylamino]butanoic acid.
| Compound Name | 2-[2-(2-methyl-6-oxo-1-pyridinyl)butanoylamino]butanoic acid |
|---|---|
| PubChem CID | 82031547 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 2-[2-(2-methyl-6-oxo-1-pyridinyl)butanoylamino]butanoic acid |
| SMILES | CCC(NC(=O)C(CC)n1c(C)cccc1=O)C(=O)O |
| InChI | InChI=1S/C14H20N2O4/c1-4-10(14(19)20)15-13(18)11(5-2)16-9(3)7-6-8-12(16)17/h6-8,10-11H,4-5H2,1-3H3,(H,15,18)(H,19,20) |
| InChIKey | CYHRRVILWDZCAK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |