C15H22N2O4S — CID 82031544
2-[2-(2-methyl-6-oxo-1-pyridinyl)butanoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 82031544) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is 2-[2-(2-methyl-6-oxo-1-pyridinyl)butanoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[2-(2-methyl-6-oxo-1-pyridinyl)butanoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 82031544 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-[2-(2-methyl-6-oxo-1-pyridinyl)butanoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CCC(C(=O)NC(CCSC)C(=O)O)n1c(C)cccc1=O |
| InChI | InChI=1S/C15H22N2O4S/c1-4-12(17-10(2)6-5-7-13(17)18)14(19)16-11(15(20)21)8-9-22-3/h5-7,11-12H,4,8-9H2,1-3H3,(H,16,19)(H,20,21) |
| InChIKey | SBUPVLWKUKFPAV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |