C17H19N3O2S — CID 82031986
N-(3-carbamothioylphenyl)-2-methyl-2-(5-methyl-2-oxo-1-pyridinyl)propanamide (PubChem CID 82031986) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is N-(3-carbamothioylphenyl)-2-methyl-2-(5-methyl-2-oxo-1-pyridinyl)propanamide.
| Compound Name | N-(3-carbamothioylphenyl)-2-methyl-2-(5-methyl-2-oxo-1-pyridinyl)propanamide |
|---|---|
| PubChem CID | 82031986 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | N-(3-carbamothioylphenyl)-2-methyl-2-(5-methyl-2-oxo-1-pyridinyl)propanamide |
| SMILES | Cc1ccc(=O)n(C(C)(C)C(=O)Nc2cccc(C(N)=S)c2)c1 |
| InChI | InChI=1S/C17H19N3O2S/c1-11-7-8-14(21)20(10-11)17(2,3)16(22)19-13-6-4-5-12(9-13)15(18)23/h4-10H,1-3H3,(H2,18,23)(H,19,22) |
| InChIKey | MHUJLJQKVLKYSE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|