C13H13N3O4S2 — CID 82032593
1-[2-(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylacetyl]pyrrolidine-2-carboxylic acid (PubChem CID 82032593) has the molecular formula C13H13N3O4S2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 1-[2-(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylacetyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylacetyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 82032593 |
| Molecular Formula | C13H13N3O4S2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 1-[2-(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylacetyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=Cc1c(SCC(=O)N2CCCC2C(=O)O)nc2sccn12 |
| InChI | InChI=1S/C13H13N3O4S2/c17-6-9-11(14-13-16(9)4-5-21-13)22-7-10(18)15-3-1-2-8(15)12(19)20/h4-6,8H,1-3,7H2,(H,19,20) |
| InChIKey | ZUUTZHZABBYXMQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|