C17H22N2O5 — CID 82033813
4-[2-(2,6-dimethyl-3-oxo-1,4-benzoxazin-4-yl)propanoylamino]butanoic acid (PubChem CID 82033813) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is 4-[2-(2,6-dimethyl-3-oxo-1,4-benzoxazin-4-yl)propanoylamino]butanoic acid.
| Compound Name | 4-[2-(2,6-dimethyl-3-oxo-1,4-benzoxazin-4-yl)propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 82033813 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 4-[2-(2,6-dimethyl-3-oxo-1,4-benzoxazin-4-yl)propanoylamino]butanoic acid |
| SMILES | Cc1ccc2c(c1)N(C(C)C(=O)NCCCC(=O)O)C(=O)C(C)O2 |
| InChI | InChI=1S/C17H22N2O5/c1-10-6-7-14-13(9-10)19(17(23)12(3)24-14)11(2)16(22)18-8-4-5-15(20)21/h6-7,9,11-12H,4-5,8H2,1-3H3,(H,18,22)(H,20,21) |
| InChIKey | JHHFDDGBBYOEQB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|