C20H22N2O2S — CID 82035242
3,5-diethyl-6-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid (PubChem CID 82035242) has the molecular formula C20H22N2O2S and a molecular weight of 354.48 g/mol. Its IUPAC name is 3,5-diethyl-6-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid.
| Compound Name | 3,5-diethyl-6-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 82035242 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 3,5-diethyl-6-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid |
| SMILES | CCc1c(-c2ccc3c(c2)CCCC3)nc2sc(C(=O)O)c(CC)n12 |
| InChI | InChI=1S/C20H22N2O2S/c1-3-15-17(14-10-9-12-7-5-6-8-13(12)11-14)21-20-22(15)16(4-2)18(25-20)19(23)24/h9-11H,3-8H2,1-2H3,(H,23,24) |
| InChIKey | KIOVVJBMGORHRK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |