C18H21N3OS — CID 82219575
[2-propyl-6-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]methanol (PubChem CID 82219575) has the molecular formula C18H21N3OS and a molecular weight of 327.45 g/mol. Its IUPAC name is [2-propyl-6-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]methanol.
| Compound Name | [2-propyl-6-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]methanol |
|---|---|
| PubChem CID | 82219575 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | [2-propyl-6-(5,6,7,8-tetrahydronaphthalen-2-yl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]methanol |
| SMILES | CCCc1nn2c(CO)c(-c3ccc4c(c3)CCCC4)nc2s1 |
| InChI | InChI=1S/C18H21N3OS/c1-2-5-16-20-21-15(11-22)17(19-18(21)23-16)14-9-8-12-6-3-4-7-13(12)10-14/h8-10,22H,2-7,11H2,1H3 |
| InChIKey | DAUBFJYFCLPUMH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |