6-ethyl-3,5-dimethylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid

C10H12N2O2S — CID 82035945

IUPAC6-ethyl-3,5-dimethylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid
SMILESCCc1nc2sc(C(=O)O)c(C)n2c1C
InChIInChI=1S/C10H12N2O2S/c1-4-7-5(2)12-6(3)8(9(13)14)15-10(12)11-7/h4H2,1-3H3,(H,13,14)
InChIKeyCNYJDDZRMKZKDI-UHFFFAOYSA-N
MW224.28 g/mol
LogP2.27
Rot. Bonds2

About 6-ethyl-3,5-dimethylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid

6-ethyl-3,5-dimethylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid (PubChem CID 82035945) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 6-ethyl-3,5-dimethylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid.

Molecular Properties

Compound Name6-ethyl-3,5-dimethylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid
PubChem CID82035945
Molecular FormulaC10H12N2O2S
Molecular Weight224.28 g/mol
Exact Mass224.06
IUPAC Name6-ethyl-3,5-dimethylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid
SMILESCCc1nc2sc(C(=O)O)c(C)n2c1C
InChIInChI=1S/C10H12N2O2S/c1-4-7-5(2)12-6(3)8(9(13)14)15-10(12)11-7/h4H2,1-3H3,(H,13,14)
InChIKeyCNYJDDZRMKZKDI-UHFFFAOYSA-N
XLogP2.27
TPSA54.60 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.28
LogP ≤ 52.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 6-ethyl-3,5-dimethylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-ethyl-3,5-dimethylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid?
The IUPAC name of 6-ethyl-3,5-dimethylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid (CID 82035945) is 6-ethyl-3,5-dimethylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid.
What is the SMILES notation for 6-ethyl-3,5-dimethylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid?
The canonical SMILES for 6-ethyl-3,5-dimethylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid is CCc1nc2sc(C(=O)O)c(C)n2c1C.
What is the InChIKey of 6-ethyl-3,5-dimethylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid?
The InChIKey is CNYJDDZRMKZKDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2S/c1-4-7-5(2)12-6(3)8(9(13)14)15-10(12)11-7/h4H2,1-3H3,(H,13,14).
What are the key properties of 6-ethyl-3,5-dimethylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid?
6-ethyl-3,5-dimethylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid has a molecular weight of 224.28 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-3,5-dimethylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid is sourced from PubChem (CID 82035945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).