C14H14F3NO3 — CID 82036474
5-ethoxy-1-ethyl-2-(trifluoromethyl)indole-3-carboxylic acid (PubChem CID 82036474) has the molecular formula C14H14F3NO3 and a molecular weight of 301.26 g/mol. Its IUPAC name is 5-ethoxy-1-ethyl-2-(trifluoromethyl)indole-3-carboxylic acid.
| Compound Name | 5-ethoxy-1-ethyl-2-(trifluoromethyl)indole-3-carboxylic acid |
|---|---|
| PubChem CID | 82036474 |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 5-ethoxy-1-ethyl-2-(trifluoromethyl)indole-3-carboxylic acid |
| SMILES | CCOc1ccc2c(c1)c(C(=O)O)c(C(F)(F)F)n2CC |
| InChI | InChI=1S/C14H14F3NO3/c1-3-18-10-6-5-8(21-4-2)7-9(10)11(13(19)20)12(18)14(15,16)17/h5-7H,3-4H2,1-2H3,(H,19,20) |
| InChIKey | BMQIYIHGSATLPT-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |