C17H21NO — CID 82037851
5-(3-methylcyclohexyl)oxynaphthalen-1-amine (PubChem CID 82037851) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is 5-(3-methylcyclohexyl)oxynaphthalen-1-amine.
| Compound Name | 5-(3-methylcyclohexyl)oxynaphthalen-1-amine |
|---|---|
| PubChem CID | 82037851 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 5-(3-methylcyclohexyl)oxynaphthalen-1-amine |
| SMILES | CC1CCCC(Oc2cccc3c(N)cccc23)C1 |
| InChI | InChI=1S/C17H21NO/c1-12-5-2-6-13(11-12)19-17-10-4-7-14-15(17)8-3-9-16(14)18/h3-4,7-10,12-13H,2,5-6,11,18H2,1H3 |
| InChIKey | NXBKXCTZJXQENS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|