C17H22O2 — CID 65455951
5-(3-methylcyclohexyl)oxy-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 65455951) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 5-(3-methylcyclohexyl)oxy-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 5-(3-methylcyclohexyl)oxy-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 65455951 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 5-(3-methylcyclohexyl)oxy-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CC1CCCC(Oc2cccc3c2CCCC3=O)C1 |
| InChI | InChI=1S/C17H22O2/c1-12-5-2-6-13(11-12)19-17-10-4-7-14-15(17)8-3-9-16(14)18/h4,7,10,12-13H,2-3,5-6,8-9,11H2,1H3 |
| InChIKey | QEURIALWMLLXGH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |