C16H18FNO2 — CID 82038950
2-[3-(2-fluorophenyl)-4,5-dimethoxyphenyl]ethanamine (PubChem CID 82038950) has the molecular formula C16H18FNO2 and a molecular weight of 275.32 g/mol. Its IUPAC name is 2-[3-(2-fluorophenyl)-4,5-dimethoxyphenyl]ethanamine.
| Compound Name | 2-[3-(2-fluorophenyl)-4,5-dimethoxyphenyl]ethanamine |
|---|---|
| PubChem CID | 82038950 |
| Molecular Formula | C16H18FNO2 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-[3-(2-fluorophenyl)-4,5-dimethoxyphenyl]ethanamine |
| SMILES | COc1cc(CCN)cc(-c2ccccc2F)c1OC |
| InChI | InChI=1S/C16H18FNO2/c1-19-15-10-11(7-8-18)9-13(16(15)20-2)12-5-3-4-6-14(12)17/h3-6,9-10H,7-8,18H2,1-2H3 |
| InChIKey | PIMRCCZLWGIGDB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |