C11H15NOS — CID 82040666
2-(3,5-dimethylphenyl)sulfanylpropanamide (PubChem CID 82040666) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)sulfanylpropanamide.
| Compound Name | 2-(3,5-dimethylphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 82040666 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 2-(3,5-dimethylphenyl)sulfanylpropanamide |
| SMILES | Cc1cc(C)cc(SC(C)C(N)=O)c1 |
| InChI | InChI=1S/C11H15NOS/c1-7-4-8(2)6-10(5-7)14-9(3)11(12)13/h4-6,9H,1-3H3,(H2,12,13) |
| InChIKey | CYBVIQNHEWLETA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |