C17H14ClNO2 — CID 82046653
2-(5-amino-2-chlorophenyl)-6,7-dimethylchromen-4-one (PubChem CID 82046653) has the molecular formula C17H14ClNO2 and a molecular weight of 299.76 g/mol. Its IUPAC name is 2-(5-amino-2-chlorophenyl)-6,7-dimethylchromen-4-one.
| Compound Name | 2-(5-amino-2-chlorophenyl)-6,7-dimethylchromen-4-one |
|---|---|
| PubChem CID | 82046653 |
| Molecular Formula | C17H14ClNO2 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 2-(5-amino-2-chlorophenyl)-6,7-dimethylchromen-4-one |
| SMILES | Cc1cc2oc(-c3cc(N)ccc3Cl)cc(=O)c2cc1C |
| InChI | InChI=1S/C17H14ClNO2/c1-9-5-13-15(20)8-17(21-16(13)6-10(9)2)12-7-11(19)3-4-14(12)18/h3-8H,19H2,1-2H3 |
| InChIKey | HIIQXKCCELZNJU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|