C11H13ClN2O3S — CID 82048446
1,3-diethyl-2-oxobenzimidazole-5-sulfonyl chloride (PubChem CID 82048446) has the molecular formula C11H13ClN2O3S and a molecular weight of 288.76 g/mol. Its IUPAC name is 1,3-diethyl-2-oxobenzimidazole-5-sulfonyl chloride.
| Compound Name | 1,3-diethyl-2-oxobenzimidazole-5-sulfonyl chloride |
|---|---|
| PubChem CID | 82048446 |
| Molecular Formula | C11H13ClN2O3S |
| Molecular Weight | 288.76 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 1,3-diethyl-2-oxobenzimidazole-5-sulfonyl chloride |
| SMILES | CCn1c(=O)n(CC)c2cc(S(=O)(=O)Cl)ccc21 |
| InChI | InChI=1S/C11H13ClN2O3S/c1-3-13-9-6-5-8(18(12,16)17)7-10(9)14(4-2)11(13)15/h5-7H,3-4H2,1-2H3 |
| InChIKey | ROGCFUWDGQGGTC-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.76 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |